C25H29Cl2N5O3S — CID 6092906
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[3,5-dichloro-4-[2-(4-hexylphenoxy)ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 6092906) has the molecular formula C25H29Cl2N5O3S and a molecular weight of 550.51 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[3,5-dichloro-4-[2-(4-hexylphenoxy)ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[3,5-dichloro-4-[2-(4-hexylphenoxy)ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6092906 |
| Molecular Formula | C25H29Cl2N5O3S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[3,5-dichloro-4-[2-(4-hexylphenoxy)ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | CCCCCCc1ccc(OCCOc2c(Cl)cc(/C=N\NC(=O)Cc3nnc(N)s3)cc2Cl)cc1 |
| InChI | InChI=1S/C25H29Cl2N5O3S/c1-2-3-4-5-6-17-7-9-19(10-8-17)34-11-12-35-24-20(26)13-18(14-21(24)27)16-29-30-22(33)15-23-31-32-25(28)36-23/h7-10,13-14,16H,2-6,11-12,15H2,1H3,(H2,28,32)(H,30,33)/b29-16- |
| InChIKey | ANCFELWBFAYCAT-MWLSYYOVSA-N |
| XLogP | 5.70 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|