C13H17NO3S — CID 68839162
2-methyl-1,1-dioxo-6,7,8,9,9a,10-hexahydro-4H-benzo[g][1,2]benzothiazin-3-one (PubChem CID 68839162) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-methyl-1,1-dioxo-6,7,8,9,9a,10-hexahydro-4H-benzo[g][1,2]benzothiazin-3-one.
| Compound Name | 2-methyl-1,1-dioxo-6,7,8,9,9a,10-hexahydro-4H-benzo[g][1,2]benzothiazin-3-one |
|---|---|
| PubChem CID | 68839162 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-methyl-1,1-dioxo-6,7,8,9,9a,10-hexahydro-4H-benzo[g][1,2]benzothiazin-3-one |
| SMILES | CN1C(=O)CC2=C(CC3CCCCC3=C2)S1(=O)=O |
| InChI | InChI=1S/C13H17NO3S/c1-14-13(15)8-11-6-9-4-2-3-5-10(9)7-12(11)18(14,16)17/h6,10H,2-5,7-8H2,1H3 |
| InChIKey | AOQAZSZVYYPYFO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |