C10H15NO — CID 131042687
(8aR)-1-methyl-2,5,6,7,8,8a-hexahydroquinolin-3-one (PubChem CID 131042687) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (8aR)-1-methyl-2,5,6,7,8,8a-hexahydroquinolin-3-one.
| Compound Name | (8aR)-1-methyl-2,5,6,7,8,8a-hexahydroquinolin-3-one |
|---|---|
| PubChem CID | 131042687 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (8aR)-1-methyl-2,5,6,7,8,8a-hexahydroquinolin-3-one |
| SMILES | CN1CC(=O)C=C2CCCC[C@H]21 |
| InChI | InChI=1S/C10H15NO/c1-11-7-9(12)6-8-4-2-3-5-10(8)11/h6,10H,2-5,7H2,1H3/t10-/m1/s1 |
| InChIKey | ZAHMZSYIKZYZPR-SNVBAGLBSA-N |
| XLogP | 1.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |