C18H19N3O6 — CID 68840449
(3-oxo-1H-indazol-2-yl) N-[(3,4,5-trimethoxyphenyl)methyl]carbamate (PubChem CID 68840449) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is (3-oxo-1H-indazol-2-yl) N-[(3,4,5-trimethoxyphenyl)methyl]carbamate.
| Compound Name | (3-oxo-1H-indazol-2-yl) N-[(3,4,5-trimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 68840449 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (3-oxo-1H-indazol-2-yl) N-[(3,4,5-trimethoxyphenyl)methyl]carbamate |
| SMILES | COc1cc(CNC(=O)On2[nH]c3ccccc3c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N3O6/c1-24-14-8-11(9-15(25-2)16(14)26-3)10-19-18(23)27-21-17(22)12-6-4-5-7-13(12)20-21/h4-9,20H,10H2,1-3H3,(H,19,23) |
| InChIKey | LPMRXJYWIABTEV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |