C25H29ClN2O14 — CID 68840510
[(2R,3S,4S,5R,6R)-6-[(2R,3S,4S,5R,6R)-5-[(4-chloro-3-nitrophenyl)methoxy]-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate (PubChem CID 68840510) has the molecular formula C25H29ClN2O14 and a molecular weight of 616.96 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2R,3S,4S,5R,6R)-5-[(4-chloro-3-nitrophenyl)methoxy]-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2R,3S,4S,5R,6R)-5-[(4-chloro-3-nitrophenyl)methoxy]-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68840510 |
| Molecular Formula | C25H29ClN2O14 |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2R,3S,4S,5R,6R)-5-[(4-chloro-3-nitrophenyl)methoxy]-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
| SMILES | O=C(OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](OCc3ccc(Cl)c([N+](=O)[O-])c3)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O)c1cccnc1 |
| InChI | InChI=1S/C25H29ClN2O14/c26-13-4-3-11(6-14(13)28(36)37)9-38-22-20(33)21(15(8-29)40-24(22)35)42-25-19(32)18(31)17(30)16(41-25)10-39-23(34)12-2-1-5-27-7-12/h1-7,15-22,24-25,29-33,35H,8-10H2/t15-,16-,17-,18+,19-,20+,21-,22-,24-,25-/m1/s1 |
| InChIKey | MBRQERSERRKZBT-ZCLSPPORSA-N |
| XLogP | -1.35 |
| TPSA | 240.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|