C20H22O3 — CID 68840842
butyl 3-phenylprop-2-enoate;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene (PubChem CID 68840842) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is butyl 3-phenylprop-2-enoate;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene.
| Compound Name | butyl 3-phenylprop-2-enoate;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene |
|---|---|
| PubChem CID | 68840842 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | butyl 3-phenylprop-2-enoate;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene |
| SMILES | CCCCOC(=O)C=Cc1ccccc1.c1cc2ccc1CO2 |
| InChI | InChI=1S/C13H16O2.C7H6O/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12;1-3-7-4-2-6(1)5-8-7/h4-10H,2-3,11H2,1H3;1-4H,5H2 |
| InChIKey | MCUJNNDFGSRKQG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|