C22H30F2N4O4S — CID 68843287
4-[4-[1-[3-(difluoromethoxy)propylsulfonyl]propyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]aniline (PubChem CID 68843287) has the molecular formula C22H30F2N4O4S and a molecular weight of 484.57 g/mol. Its IUPAC name is 4-[4-[1-[3-(difluoromethoxy)propylsulfonyl]propyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]aniline.
| Compound Name | 4-[4-[1-[3-(difluoromethoxy)propylsulfonyl]propyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 68843287 |
| Molecular Formula | C22H30F2N4O4S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 4-[4-[1-[3-(difluoromethoxy)propylsulfonyl]propyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]aniline |
| SMILES | CCC(c1cc(N2CCOC[C@@H]2C)nc(-c2ccc(N)cc2)n1)S(=O)(=O)CCCOC(F)F |
| InChI | InChI=1S/C22H30F2N4O4S/c1-3-19(33(29,30)12-4-10-32-22(23)24)18-13-20(28-9-11-31-14-15(28)2)27-21(26-18)16-5-7-17(25)8-6-16/h5-8,13,15,19,22H,3-4,9-12,14,25H2,1-2H3/t15-,19?/m0/s1 |
| InChIKey | OMYDVEHWUFFLMA-FUKCDUGKSA-N |
| XLogP | 3.45 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|