C20H28N4O4 — CID 68844014
6-[(3-ethoxy-4-methoxyphenyl)methyl-piperidin-4-ylamino]-4-methoxy-1H-pyrimidin-2-one (PubChem CID 68844014) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-[(3-ethoxy-4-methoxyphenyl)methyl-piperidin-4-ylamino]-4-methoxy-1H-pyrimidin-2-one.
| Compound Name | 6-[(3-ethoxy-4-methoxyphenyl)methyl-piperidin-4-ylamino]-4-methoxy-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 68844014 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 6-[(3-ethoxy-4-methoxyphenyl)methyl-piperidin-4-ylamino]-4-methoxy-1H-pyrimidin-2-one |
| SMILES | CCOc1cc(CN(c2cc(OC)nc(=O)[nH]2)C2CCNCC2)ccc1OC |
| InChI | InChI=1S/C20H28N4O4/c1-4-28-17-11-14(5-6-16(17)26-2)13-24(15-7-9-21-10-8-15)18-12-19(27-3)23-20(25)22-18/h5-6,11-12,15,21H,4,7-10,13H2,1-3H3,(H,22,23,25) |
| InChIKey | GJZIXGWJCUVMAJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |