C18H26F3NO2 — CID 68852821
2-amino-1-[2-[(S)-cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 68852821) has the molecular formula C18H26F3NO2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 2-amino-1-[2-[(S)-cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2-amino-1-[2-[(S)-cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 68852821 |
| Molecular Formula | C18H26F3NO2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-amino-1-[2-[(S)-cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CO[C@H](c1ccc(C(F)(F)F)cc1C(O)C(C)N)C1CCCCC1 |
| InChI | InChI=1S/C18H26F3NO2/c1-11(22)16(23)15-10-13(18(19,20)21)8-9-14(15)17(24-2)12-6-4-3-5-7-12/h8-12,16-17,23H,3-7,22H2,1-2H3/t11?,16?,17-/m0/s1 |
| InChIKey | CRCYQLPOYZKQEH-XCKKERBNSA-N |
| XLogP | 4.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |