C26H25F9N2O — CID 86615050
[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]methyl]cyanamide (PubChem CID 86615050) has the molecular formula C26H25F9N2O and a molecular weight of 552.48 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]methyl]cyanamide.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]methyl]cyanamide |
|---|---|
| PubChem CID | 86615050 |
| Molecular Formula | C26H25F9N2O |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclohexyl(methoxy)methyl]-5-(trifluoromethyl)phenyl]methyl]cyanamide |
| SMILES | COC(c1ccc(C(F)(F)F)cc1CN(C#N)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H25F9N2O/c1-38-23(17-5-3-2-4-6-17)22-8-7-19(24(27,28)29)11-18(22)14-37(15-36)13-16-9-20(25(30,31)32)12-21(10-16)26(33,34)35/h7-12,17,23H,2-6,13-14H2,1H3 |
| InChIKey | DBFZKSVBVZHLRS-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|