C28H34F9N5O — CID 143539068
2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-cyclohexyl-1-methoxyethyl)-5-(trifluoromethyl)phenyl]methyl]-3-(methylamino)guanidine (PubChem CID 143539068) has the molecular formula C28H34F9N5O and a molecular weight of 627.60 g/mol. Its IUPAC name is 2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-cyclohexyl-1-methoxyethyl)-5-(trifluoromethyl)phenyl]methyl]-3-(methylamino)guanidine.
| Compound Name | 2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-cyclohexyl-1-methoxyethyl)-5-(trifluoromethyl)phenyl]methyl]-3-(methylamino)guanidine |
|---|---|
| PubChem CID | 143539068 |
| Molecular Formula | C28H34F9N5O |
| Molecular Weight | 627.60 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-cyclohexyl-1-methoxyethyl)-5-(trifluoromethyl)phenyl]methyl]-3-(methylamino)guanidine |
| SMILES | CNN/C(=N\N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc(C(F)(F)F)ccc1C(C)(OC)C1CCCCC1 |
| InChI | InChI=1S/C28H34F9N5O/c1-25(43-3,19-7-5-4-6-8-19)23-10-9-20(26(29,30)31)13-18(23)16-42(24(40-38)41-39-2)15-17-11-21(27(32,33)34)14-22(12-17)28(35,36)37/h9-14,19,39H,4-8,15-16,38H2,1-3H3,(H,40,41) |
| InChIKey | UVHFLOCIKKRNQE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|