C11H12F6N4 — CID 143574021
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(methylamino)guanidine (PubChem CID 143574021) has the molecular formula C11H12F6N4 and a molecular weight of 314.23 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(methylamino)guanidine.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(methylamino)guanidine |
|---|---|
| PubChem CID | 143574021 |
| Molecular Formula | C11H12F6N4 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-(methylamino)guanidine |
| SMILES | CNN/C(N)=N/Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F6N4/c1-19-21-9(18)20-5-6-2-7(10(12,13)14)4-8(3-6)11(15,16)17/h2-4,19H,5H2,1H3,(H3,18,20,21) |
| InChIKey | QFPFUSYJAUZOHX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|