C11H8F6N4 — CID 142011497
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-cyanoguanidine (PubChem CID 142011497) has the molecular formula C11H8F6N4 and a molecular weight of 310.20 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-cyanoguanidine.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-cyanoguanidine |
|---|---|
| PubChem CID | 142011497 |
| Molecular Formula | C11H8F6N4 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-cyanoguanidine |
| SMILES | N#CN/C(N)=N/Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F6N4/c12-10(13,14)7-1-6(4-20-9(19)21-5-18)2-8(3-7)11(15,16)17/h1-3H,4H2,(H3,19,20,21) |
| InChIKey | SGSSFCXRNLGNNJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|