C12H13F3N4O2 — CID 122082212
1-cyclopropyl-2-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 122082212) has the molecular formula C12H13F3N4O2 and a molecular weight of 302.26 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 122082212 |
| Molecular Formula | C12H13F3N4O2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-cyclopropyl-2-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1cc([N+](=O)[O-])cc(C(F)(F)F)c1)NC1CC1 |
| InChI | InChI=1S/C12H13F3N4O2/c13-12(14,15)8-3-7(4-10(5-8)19(20)21)6-17-11(16)18-9-1-2-9/h3-5,9H,1-2,6H2,(H3,16,17,18) |
| InChIKey | YCCVQHPMJVKWQY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|