C23H33BrN2O4 — CID 68853407
tert-butyl 4-[2-(4-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylate (PubChem CID 68853407) has the molecular formula C23H33BrN2O4 and a molecular weight of 481.43 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68853407 |
| Molecular Formula | C23H33BrN2O4 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | tert-butyl 4-[2-(4-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C(c2ccc(Br)cc2)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C23H33BrN2O4/c1-22(2,3)30-21(28)26-15-13-25(14-16-26)20(27)19(17-7-9-18(24)10-8-17)23(29)11-5-4-6-12-23/h7-10,19,29H,4-6,11-16H2,1-3H3 |
| InChIKey | WAGWARNEHXDMTA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |