C26H30ClN5O — CID 68854212
N-[2-chloro-5-[(2-phenylethylamino)methyl]phenyl]-6-(4-methylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 68854212) has the molecular formula C26H30ClN5O and a molecular weight of 464.01 g/mol. Its IUPAC name is N-[2-chloro-5-[(2-phenylethylamino)methyl]phenyl]-6-(4-methylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[2-chloro-5-[(2-phenylethylamino)methyl]phenyl]-6-(4-methylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68854212 |
| Molecular Formula | C26H30ClN5O |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[2-chloro-5-[(2-phenylethylamino)methyl]phenyl]-6-(4-methylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3cc(CNCCc4ccccc4)ccc3Cl)cn2)CC1 |
| InChI | InChI=1S/C26H30ClN5O/c1-31-13-15-32(16-14-31)25-10-8-22(19-29-25)26(33)30-24-17-21(7-9-23(24)27)18-28-12-11-20-5-3-2-4-6-20/h2-10,17,19,28H,11-16,18H2,1H3,(H,30,33) |
| InChIKey | YGYANVZQIMJIPI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|