C13H13ClF2N2O — CID 68855710
2-chloro-N-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]acetamide (PubChem CID 68855710) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is 2-chloro-N-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]acetamide.
| Compound Name | 2-chloro-N-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]acetamide |
|---|---|
| PubChem CID | 68855710 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-chloro-N-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]acetamide |
| SMILES | O=C(CCl)NC1C2CN(c3ccc(F)cc3F)CC21 |
| InChI | InChI=1S/C13H13ClF2N2O/c14-4-12(19)17-13-8-5-18(6-9(8)13)11-2-1-7(15)3-10(11)16/h1-3,8-9,13H,4-6H2,(H,17,19) |
| InChIKey | DYCWBSMUSKQWMR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|