About tert-butyl spiro[2.5]octan-6-yl carbonate
tert-butyl spiro[2.5]octan-6-yl carbonate (PubChem CID 68856404) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is tert-butyl spiro[2.5]octan-6-yl carbonate.
Molecular Properties
| Compound Name | tert-butyl spiro[2.5]octan-6-yl carbonate |
| PubChem CID | 68856404 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | tert-butyl spiro[2.5]octan-6-yl carbonate |
| SMILES | CC(C)(C)OC(=O)OC1CCC2(CC1)CC2 |
| InChI | InChI=1S/C13H22O3/c1-12(2,3)16-11(14)15-10-4-6-13(7-5-10)8-9-13/h10H,4-9H2,1-3H3 |
| InChIKey | DIGQEHQFHMHQCJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl spiro[2.5]octan-6-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl spiro[2.5]octan-6-yl carbonate?
The IUPAC name of tert-butyl spiro[2.5]octan-6-yl carbonate (CID 68856404) is tert-butyl spiro[2.5]octan-6-yl carbonate.
What is the SMILES notation for tert-butyl spiro[2.5]octan-6-yl carbonate?
The canonical SMILES for tert-butyl spiro[2.5]octan-6-yl carbonate is CC(C)(C)OC(=O)OC1CCC2(CC1)CC2.
What is the InChIKey of tert-butyl spiro[2.5]octan-6-yl carbonate?
The InChIKey is DIGQEHQFHMHQCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-12(2,3)16-11(14)15-10-4-6-13(7-5-10)8-9-13/h10H,4-9H2,1-3H3.
What are the key properties of tert-butyl spiro[2.5]octan-6-yl carbonate?
tert-butyl spiro[2.5]octan-6-yl carbonate has a molecular weight of 226.32 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl spiro[2.5]octan-6-yl carbonate is sourced from PubChem (CID 68856404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).