C22H28N4O3 — CID 68862253
[4-(acetamidomethyl)anilino]-(2-methyl-6-piperidin-1-ylphenyl)carbamic acid (PubChem CID 68862253) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is [4-(acetamidomethyl)anilino]-(2-methyl-6-piperidin-1-ylphenyl)carbamic acid.
| Compound Name | [4-(acetamidomethyl)anilino]-(2-methyl-6-piperidin-1-ylphenyl)carbamic acid |
|---|---|
| PubChem CID | 68862253 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [4-(acetamidomethyl)anilino]-(2-methyl-6-piperidin-1-ylphenyl)carbamic acid |
| SMILES | CC(=O)NCc1ccc(NN(C(=O)O)c2c(C)cccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-16-7-6-8-20(25-13-4-3-5-14-25)21(16)26(22(28)29)24-19-11-9-18(10-12-19)15-23-17(2)27/h6-12,24H,3-5,13-15H2,1-2H3,(H,23,27)(H,28,29) |
| InChIKey | CGHMAKOTUSWDFK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|