C15H13ClN2O6S2 — CID 68863542
2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 68863542) has the molecular formula C15H13ClN2O6S2 and a molecular weight of 416.86 g/mol. Its IUPAC name is 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 68863542 |
| Molecular Formula | C15H13ClN2O6S2 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1c(NS(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)ccc2c1CCCC2 |
| InChI | InChI=1S/C15H13ClN2O6S2/c16-14-11(18(21)22)7-12(25-14)26(23,24)17-10-6-5-8-3-1-2-4-9(8)13(10)15(19)20/h5-7,17H,1-4H2,(H,19,20) |
| InChIKey | KINIKNQAKUGIND-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|