C13H12BrClN2O2S — CID 68866178
N-[4-bromo-2-[1-hydroxy-1-(1,3-thiazol-2-yl)ethyl]phenyl]-2-chloroacetamide (PubChem CID 68866178) has the molecular formula C13H12BrClN2O2S and a molecular weight of 375.68 g/mol. Its IUPAC name is N-[4-bromo-2-[1-hydroxy-1-(1,3-thiazol-2-yl)ethyl]phenyl]-2-chloroacetamide.
| Compound Name | N-[4-bromo-2-[1-hydroxy-1-(1,3-thiazol-2-yl)ethyl]phenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 68866178 |
| Molecular Formula | C13H12BrClN2O2S |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | N-[4-bromo-2-[1-hydroxy-1-(1,3-thiazol-2-yl)ethyl]phenyl]-2-chloroacetamide |
| SMILES | CC(O)(c1nccs1)c1cc(Br)ccc1NC(=O)CCl |
| InChI | InChI=1S/C13H12BrClN2O2S/c1-13(19,12-16-4-5-20-12)9-6-8(14)2-3-10(9)17-11(18)7-15/h2-6,19H,7H2,1H3,(H,17,18) |
| InChIKey | VHIHWKZMXYTOQY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|