C23H21BrClNO4 — CID 68977017
N-[4-bromo-2-[hydroxy-bis(4-methoxyphenyl)methyl]phenyl]-2-chloroacetamide (PubChem CID 68977017) has the molecular formula C23H21BrClNO4 and a molecular weight of 490.78 g/mol. Its IUPAC name is N-[4-bromo-2-[hydroxy-bis(4-methoxyphenyl)methyl]phenyl]-2-chloroacetamide.
| Compound Name | N-[4-bromo-2-[hydroxy-bis(4-methoxyphenyl)methyl]phenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 68977017 |
| Molecular Formula | C23H21BrClNO4 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | N-[4-bromo-2-[hydroxy-bis(4-methoxyphenyl)methyl]phenyl]-2-chloroacetamide |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)c2cc(Br)ccc2NC(=O)CCl)cc1 |
| InChI | InChI=1S/C23H21BrClNO4/c1-29-18-8-3-15(4-9-18)23(28,16-5-10-19(30-2)11-6-16)20-13-17(24)7-12-21(20)26-22(27)14-25/h3-13,28H,14H2,1-2H3,(H,26,27) |
| InChIKey | IAYJRQCKRZYVJJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|