C22H30N2O — CID 68866970
2-[2-[(3R)-3-aminopyrrolidin-1-yl]-1-naphthalen-2-ylethyl]cyclohexan-1-ol (PubChem CID 68866970) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-[2-[(3R)-3-aminopyrrolidin-1-yl]-1-naphthalen-2-ylethyl]cyclohexan-1-ol.
| Compound Name | 2-[2-[(3R)-3-aminopyrrolidin-1-yl]-1-naphthalen-2-ylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 68866970 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2-[2-[(3R)-3-aminopyrrolidin-1-yl]-1-naphthalen-2-ylethyl]cyclohexan-1-ol |
| SMILES | N[C@@H]1CCN(CC(c2ccc3ccccc3c2)C2CCCCC2O)C1 |
| InChI | InChI=1S/C22H30N2O/c23-19-11-12-24(14-19)15-21(20-7-3-4-8-22(20)25)18-10-9-16-5-1-2-6-17(16)13-18/h1-2,5-6,9-10,13,19-22,25H,3-4,7-8,11-12,14-15,23H2/t19-,20?,21?,22?/m1/s1 |
| InChIKey | YDYMFOOYXXTMSN-AOFALMCMSA-N |
| XLogP | 3.51 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |