C21H25N3O — CID 97075133
(1R)-2-[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]-1-naphthalen-2-ylethanol (PubChem CID 97075133) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (1R)-2-[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]-1-naphthalen-2-ylethanol.
| Compound Name | (1R)-2-[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]-1-naphthalen-2-ylethanol |
|---|---|
| PubChem CID | 97075133 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (1R)-2-[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]-1-naphthalen-2-ylethanol |
| SMILES | Cn1nccc1[C@@H]1CCCN(C[C@H](O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C21H25N3O/c1-23-20(10-11-22-23)19-7-4-12-24(14-19)15-21(25)18-9-8-16-5-2-3-6-17(16)13-18/h2-3,5-6,8-11,13,19,21,25H,4,7,12,14-15H2,1H3/t19-,21+/m1/s1 |
| InChIKey | DGIGJTYOTHPKRQ-CTNGQTDRSA-N |
| XLogP | 3.49 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |