C16H21N5 — CID 68869782
9-(4-aminobutyl)-2-ethylpyrazolo[3,4-c]quinolin-4-amine (PubChem CID 68869782) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 9-(4-aminobutyl)-2-ethylpyrazolo[3,4-c]quinolin-4-amine.
| Compound Name | 9-(4-aminobutyl)-2-ethylpyrazolo[3,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 68869782 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 9-(4-aminobutyl)-2-ethylpyrazolo[3,4-c]quinolin-4-amine |
| SMILES | CCn1cc2c(n1)c(N)nc1cccc(CCCCN)c12 |
| InChI | InChI=1S/C16H21N5/c1-2-21-10-12-14-11(6-3-4-9-17)7-5-8-13(14)19-16(18)15(12)20-21/h5,7-8,10H,2-4,6,9,17H2,1H3,(H2,18,19) |
| InChIKey | CIDRVFQRMJURBQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|