C22H25NO4 — CID 68871834
3-ethyl-2-[2-(4-hydroxy-3-methoxyphenyl)-1-benzofuran-5-yl]pentanamide (PubChem CID 68871834) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-ethyl-2-[2-(4-hydroxy-3-methoxyphenyl)-1-benzofuran-5-yl]pentanamide.
| Compound Name | 3-ethyl-2-[2-(4-hydroxy-3-methoxyphenyl)-1-benzofuran-5-yl]pentanamide |
|---|---|
| PubChem CID | 68871834 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-ethyl-2-[2-(4-hydroxy-3-methoxyphenyl)-1-benzofuran-5-yl]pentanamide |
| SMILES | CCC(CC)C(C(N)=O)c1ccc2oc(-c3ccc(O)c(OC)c3)cc2c1 |
| InChI | InChI=1S/C22H25NO4/c1-4-13(5-2)21(22(23)25)15-7-9-18-16(10-15)12-19(27-18)14-6-8-17(24)20(11-14)26-3/h6-13,21,24H,4-5H2,1-3H3,(H2,23,25) |
| InChIKey | HSYQYKDQBDYQRF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |