About 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene
4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene (PubChem CID 68879810) has the molecular formula C15H10Br2F2N2O2
and a molecular weight of 448.06 g/mol. Its IUPAC name is 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene.
Molecular Properties
| Compound Name | 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene |
| PubChem CID | 68879810 |
| Molecular Formula | C15H10Br2F2N2O2 |
| Molecular Weight | 448.06 g/mol |
| Exact Mass | 445.91 |
| IUPAC Name | 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene |
| SMILES | Cc1c(Br)cc(F)cc1[N+](=O)[O-].Fc1cc(Br)c2cc[nH]c2c1 |
| InChI | InChI=1S/C8H5BrFN.C7H5BrFNO2/c9-7-3-5(10)4-8-6(7)1-2-11-8;1-4-6(8)2-5(9)3-7(4)10(11)12/h1-4,11H;2-3H,1H3 |
| InChIKey | IYUWZFJCVPVEMU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.06 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene?
The IUPAC name of 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene (CID 68879810) is 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene.
What is the SMILES notation for 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene?
The canonical SMILES for 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene is Cc1c(Br)cc(F)cc1[N+](=O)[O-].Fc1cc(Br)c2cc[nH]c2c1.
What is the InChIKey of 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene?
The InChIKey is IYUWZFJCVPVEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrFN.C7H5BrFNO2/c9-7-3-5(10)4-8-6(7)1-2-11-8;1-4-6(8)2-5(9)3-7(4)10(11)12/h1-4,11H;2-3H,1H3.
What are the key properties of 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene?
4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene has a molecular weight of 448.06 g/mol, XLogP of 5.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-fluoro-1H-indole;1-bromo-5-fluoro-2-methyl-3-nitrobenzene is sourced from PubChem (CID 68879810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).