C17H18N4O4 — CID 157280625
2,5-dimethyl-3-nitroaniline;6-methyl-4-nitro-1H-indole (PubChem CID 157280625) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2,5-dimethyl-3-nitroaniline;6-methyl-4-nitro-1H-indole.
| Compound Name | 2,5-dimethyl-3-nitroaniline;6-methyl-4-nitro-1H-indole |
|---|---|
| PubChem CID | 157280625 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2,5-dimethyl-3-nitroaniline;6-methyl-4-nitro-1H-indole |
| SMILES | Cc1cc(N)c(C)c([N+](=O)[O-])c1.Cc1cc([N+](=O)[O-])c2cc[nH]c2c1 |
| InChI | InChI=1S/C9H8N2O2.C8H10N2O2/c1-6-4-8-7(2-3-10-8)9(5-6)11(12)13;1-5-3-7(9)6(2)8(4-5)10(11)12/h2-5,10H,1H3;3-4H,9H2,1-2H3 |
| InChIKey | AZPUNPVZRCFONW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|