C17H21N5O3 — CID 6888069
N'-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-N-(4-methoxyphenyl)butanediamide (PubChem CID 6888069) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is N'-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-N-(4-methoxyphenyl)butanediamide.
| Compound Name | N'-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-N-(4-methoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 6888069 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N'-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-N-(4-methoxyphenyl)butanediamide |
| SMILES | COc1ccc(NC(=O)CCC(=O)N/N=C/c2cn(C)nc2C)cc1 |
| InChI | InChI=1S/C17H21N5O3/c1-12-13(11-22(2)21-12)10-18-20-17(24)9-8-16(23)19-14-4-6-15(25-3)7-5-14/h4-7,10-11H,8-9H2,1-3H3,(H,19,23)(H,20,24)/b18-10+ |
| InChIKey | JIRUROCSNCALBY-VCHYOVAHSA-N |
| XLogP | 1.61 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|