C11H15N5 — CID 68880752
2,3-dimethyl-N-[(2-methyltetrazol-5-yl)methyl]aniline (PubChem CID 68880752) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(2-methyltetrazol-5-yl)methyl]aniline.
| Compound Name | 2,3-dimethyl-N-[(2-methyltetrazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 68880752 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2,3-dimethyl-N-[(2-methyltetrazol-5-yl)methyl]aniline |
| SMILES | Cc1cccc(NCc2nnn(C)n2)c1C |
| InChI | InChI=1S/C11H15N5/c1-8-5-4-6-10(9(8)2)12-7-11-13-15-16(3)14-11/h4-6,12H,7H2,1-3H3 |
| InChIKey | VCBHZUZUFMUZKP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |