C18H20N2O2 — CID 68882474
(5S,6S)-6-[(2-methoxyphenyl)methyl]-5-phenylpiperazin-2-one (PubChem CID 68882474) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (5S,6S)-6-[(2-methoxyphenyl)methyl]-5-phenylpiperazin-2-one.
| Compound Name | (5S,6S)-6-[(2-methoxyphenyl)methyl]-5-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 68882474 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (5S,6S)-6-[(2-methoxyphenyl)methyl]-5-phenylpiperazin-2-one |
| SMILES | COc1ccccc1C[C@@H]1NC(=O)CN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-22-16-10-6-5-9-14(16)11-15-18(19-12-17(21)20-15)13-7-3-2-4-8-13/h2-10,15,18-19H,11-12H2,1H3,(H,20,21)/t15-,18-/m0/s1 |
| InChIKey | CEMDGQOOAFDDDJ-YJBOKZPZSA-N |
| XLogP | 2.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |