C15H13ClN4O2 — CID 68886644
(3-amino-1H-indazol-6-yl) N-[(3-chlorophenyl)methyl]carbamate (PubChem CID 68886644) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is (3-amino-1H-indazol-6-yl) N-[(3-chlorophenyl)methyl]carbamate.
| Compound Name | (3-amino-1H-indazol-6-yl) N-[(3-chlorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 68886644 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (3-amino-1H-indazol-6-yl) N-[(3-chlorophenyl)methyl]carbamate |
| SMILES | Nc1n[nH]c2cc(OC(=O)NCc3cccc(Cl)c3)ccc12 |
| InChI | InChI=1S/C15H13ClN4O2/c16-10-3-1-2-9(6-10)8-18-15(21)22-11-4-5-12-13(7-11)19-20-14(12)17/h1-7H,8H2,(H,18,21)(H3,17,19,20) |
| InChIKey | WYJZYPIQHPNZJX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |