C29H31N5O5S2 — CID 68887719
[4-(2,2-diphenylacetyl)-1-thiophen-2-ylsulfonylpiperazin-2-yl] N-(3-imidazol-1-ylpropyl)carbamate (PubChem CID 68887719) has the molecular formula C29H31N5O5S2 and a molecular weight of 593.73 g/mol. Its IUPAC name is [4-(2,2-diphenylacetyl)-1-thiophen-2-ylsulfonylpiperazin-2-yl] N-(3-imidazol-1-ylpropyl)carbamate.
| Compound Name | [4-(2,2-diphenylacetyl)-1-thiophen-2-ylsulfonylpiperazin-2-yl] N-(3-imidazol-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 68887719 |
| Molecular Formula | C29H31N5O5S2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | [4-(2,2-diphenylacetyl)-1-thiophen-2-ylsulfonylpiperazin-2-yl] N-(3-imidazol-1-ylpropyl)carbamate |
| SMILES | O=C(NCCCn1ccnc1)OC1CN(C(=O)C(c2ccccc2)c2ccccc2)CCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C29H31N5O5S2/c35-28(27(23-9-3-1-4-10-23)24-11-5-2-6-12-24)33-18-19-34(41(37,38)26-13-7-20-40-26)25(21-33)39-29(36)31-14-8-16-32-17-15-30-22-32/h1-7,9-13,15,17,20,22,25,27H,8,14,16,18-19,21H2,(H,31,36) |
| InChIKey | IHEQBZWYWXSHPS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|