C13H13FN4O2 — CID 68894810
5-amino-1-ethyl-3-(3-fluorophenyl)-6-oxopyridazine-4-carboxamide (PubChem CID 68894810) has the molecular formula C13H13FN4O2 and a molecular weight of 276.27 g/mol. Its IUPAC name is 5-amino-1-ethyl-3-(3-fluorophenyl)-6-oxopyridazine-4-carboxamide.
| Compound Name | 5-amino-1-ethyl-3-(3-fluorophenyl)-6-oxopyridazine-4-carboxamide |
|---|---|
| PubChem CID | 68894810 |
| Molecular Formula | C13H13FN4O2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-amino-1-ethyl-3-(3-fluorophenyl)-6-oxopyridazine-4-carboxamide |
| SMILES | CCn1nc(-c2cccc(F)c2)c(C(N)=O)c(N)c1=O |
| InChI | InChI=1S/C13H13FN4O2/c1-2-18-13(20)10(15)9(12(16)19)11(17-18)7-4-3-5-8(14)6-7/h3-6H,2,15H2,1H3,(H2,16,19) |
| InChIKey | JSZQDBAFQVJEAT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |