C17H19N3O — CID 68896318
1-(furan-3-ylmethyl)-3-piperidin-4-ylpyrrolo[2,3-b]pyridine (PubChem CID 68896318) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3-piperidin-4-ylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-(furan-3-ylmethyl)-3-piperidin-4-ylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 68896318 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3-piperidin-4-ylpyrrolo[2,3-b]pyridine |
| SMILES | c1cnc2c(c1)c(C1CCNCC1)cn2Cc1ccoc1 |
| InChI | InChI=1S/C17H19N3O/c1-2-15-16(14-3-7-18-8-4-14)11-20(17(15)19-6-1)10-13-5-9-21-12-13/h1-2,5-6,9,11-12,14,18H,3-4,7-8,10H2 |
| InChIKey | WZAOTRHGJBEFOH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |