C13H15FN2O3 — CID 68896399
[1-[(4-fluorophenyl)methyl]-6-oxopiperazin-2-yl] acetate (PubChem CID 68896399) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]-6-oxopiperazin-2-yl] acetate.
| Compound Name | [1-[(4-fluorophenyl)methyl]-6-oxopiperazin-2-yl] acetate |
|---|---|
| PubChem CID | 68896399 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]-6-oxopiperazin-2-yl] acetate |
| SMILES | CC(=O)OC1CNCC(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O3/c1-9(17)19-13-7-15-6-12(18)16(13)8-10-2-4-11(14)5-3-10/h2-5,13,15H,6-8H2,1H3 |
| InChIKey | XIIBEJIPZQSDRC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |