About cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol
cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol (PubChem CID 68900127) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol.
Molecular Properties
| Compound Name | cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol |
| PubChem CID | 68900127 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol |
| SMILES | CC(c1ccc(O)cc1)c1ccc(O)cc1.N#CO.N#CO |
| InChI | InChI=1S/C14H14O2.2CHNO/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12;2*2-1-3/h2-10,15-16H,1H3;2*3H |
| InChIKey | JHQPJHHMCKLXIR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol?
The IUPAC name of cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol (CID 68900127) is cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol.
What is the SMILES notation for cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol?
The canonical SMILES for cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol is CC(c1ccc(O)cc1)c1ccc(O)cc1.N#CO.N#CO.
What is the InChIKey of cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol?
The InChIKey is JHQPJHHMCKLXIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.2CHNO/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12;2*2-1-3/h2-10,15-16H,1H3;2*3H.
What are the key properties of cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol?
cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol has a molecular weight of 300.31 g/mol, XLogP of 2.93, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;4-[1-(4-hydroxyphenyl)ethyl]phenol is sourced from PubChem (CID 68900127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).