C24H27N3O2 — CID 68900828
9-(4-morpholin-4-ylbutylamino)-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 68900828) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 9-(4-morpholin-4-ylbutylamino)-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
| Compound Name | 9-(4-morpholin-4-ylbutylamino)-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 68900828 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 9-(4-morpholin-4-ylbutylamino)-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2c(c3ccccc13)Cc1cc(NCCCCN3CCOCC3)ccc1-2 |
| InChI | InChI=1S/C24H27N3O2/c28-24-21-6-2-1-5-20(21)22-16-17-15-18(7-8-19(17)23(22)26-24)25-9-3-4-10-27-11-13-29-14-12-27/h1-2,5-8,15,25H,3-4,9-14,16H2,(H,26,28) |
| InChIKey | GFTVIWZLLVVGFQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|