About 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine
1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine (PubChem CID 68902320) has the molecular formula C18H20ClN3O
and a molecular weight of 329.83 g/mol. Its IUPAC name is 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine.
Molecular Properties
| Compound Name | 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine |
| PubChem CID | 68902320 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine |
| SMILES | Nc1ncc2c(c1Cl)COC21CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H20ClN3O/c19-16-14-12-23-18(15(14)10-21-17(16)20)6-8-22(9-7-18)11-13-4-2-1-3-5-13/h1-5,10H,6-9,11-12H2,(H2,20,21) |
| InChIKey | OCUMRYURHHPRSA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine?
The IUPAC name of 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine (CID 68902320) is 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine.
What is the SMILES notation for 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine?
The canonical SMILES for 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine is Nc1ncc2c(c1Cl)COC21CCN(Cc2ccccc2)CC1.
What is the InChIKey of 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine?
The InChIKey is OCUMRYURHHPRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClN3O/c19-16-14-12-23-18(15(14)10-21-17(16)20)6-8-22(9-7-18)11-13-4-2-1-3-5-13/h1-5,10H,6-9,11-12H2,(H2,20,21).
What are the key properties of 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine?
1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine has a molecular weight of 329.83 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-benzyl-7-chlorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-amine is sourced from PubChem (CID 68902320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).