C12H11BO4S — CID 68904358
[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid (PubChem CID 68904358) has the molecular formula C12H11BO4S and a molecular weight of 262.09 g/mol. Its IUPAC name is [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid.
| Compound Name | [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid |
|---|---|
| PubChem CID | 68904358 |
| Molecular Formula | C12H11BO4S |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid |
| SMILES | OB(O)c1ccc(-c2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C12H11BO4S/c14-13(15)12-4-3-11(18-12)8-1-2-9-10(7-8)17-6-5-16-9/h1-4,7,14-15H,5-6H2 |
| InChIKey | PGCWHMJTNUYKPL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|