[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid

C12H11BO4S — CID 68904358

IUPAC[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid
SMILESOB(O)c1ccc(-c2ccc3c(c2)OCCO3)s1
InChIInChI=1S/C12H11BO4S/c14-13(15)12-4-3-11(18-12)8-1-2-9-10(7-8)17-6-5-16-9/h1-4,7,14-15H,5-6H2
InChIKeyPGCWHMJTNUYKPL-UHFFFAOYSA-N
MW262.09 g/mol
LogP0.87
Rot. Bonds2

About [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid

[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid (PubChem CID 68904358) has the molecular formula C12H11BO4S and a molecular weight of 262.09 g/mol. Its IUPAC name is [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid.

Molecular Properties

Compound Name[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid
PubChem CID68904358
Molecular FormulaC12H11BO4S
Molecular Weight262.09 g/mol
Exact Mass262.05
IUPAC Name[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid
SMILESOB(O)c1ccc(-c2ccc3c(c2)OCCO3)s1
InChIInChI=1S/C12H11BO4S/c14-13(15)12-4-3-11(18-12)8-1-2-9-10(7-8)17-6-5-16-9/h1-4,7,14-15H,5-6H2
InChIKeyPGCWHMJTNUYKPL-UHFFFAOYSA-N
XLogP0.87
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.09
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid?
The IUPAC name of [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid (CID 68904358) is [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid.
What is the SMILES notation for [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid?
The canonical SMILES for [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid is OB(O)c1ccc(-c2ccc3c(c2)OCCO3)s1.
What is the InChIKey of [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid?
The InChIKey is PGCWHMJTNUYKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BO4S/c14-13(15)12-4-3-11(18-12)8-1-2-9-10(7-8)17-6-5-16-9/h1-4,7,14-15H,5-6H2.
What are the key properties of [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid?
[5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid has a molecular weight of 262.09 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophen-2-yl]boronic acid is sourced from PubChem (CID 68904358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).