C23H32N2O2 — CID 68905991
1-(2-adamantyl)-3-(3-methyl-2-oxo-5-phenylpentyl)urea (PubChem CID 68905991) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-(3-methyl-2-oxo-5-phenylpentyl)urea.
| Compound Name | 1-(2-adamantyl)-3-(3-methyl-2-oxo-5-phenylpentyl)urea |
|---|---|
| PubChem CID | 68905991 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-(2-adamantyl)-3-(3-methyl-2-oxo-5-phenylpentyl)urea |
| SMILES | CC(CCc1ccccc1)C(=O)CNC(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H32N2O2/c1-15(7-8-16-5-3-2-4-6-16)21(26)14-24-23(27)25-22-19-10-17-9-18(12-19)13-20(22)11-17/h2-6,15,17-20,22H,7-14H2,1H3,(H2,24,25,27) |
| InChIKey | OSTAYWIAHTWWHV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |