C29H36N4O3 — CID 59383586
2-phenylethyl 2-(2-adamantylcarbamoylamino)-3-(3-carbamimidoylphenyl)propanoate (PubChem CID 59383586) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 2-phenylethyl 2-(2-adamantylcarbamoylamino)-3-(3-carbamimidoylphenyl)propanoate.
| Compound Name | 2-phenylethyl 2-(2-adamantylcarbamoylamino)-3-(3-carbamimidoylphenyl)propanoate |
|---|---|
| PubChem CID | 59383586 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-phenylethyl 2-(2-adamantylcarbamoylamino)-3-(3-carbamimidoylphenyl)propanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(NC(=O)NC2C3CC4CC(C3)CC2C4)C(=O)OCCc2ccccc2)c1 |
| InChI | InChI=1S/C29H36N4O3/c30-27(31)22-8-4-7-19(12-22)17-25(28(34)36-10-9-18-5-2-1-3-6-18)32-29(35)33-26-23-13-20-11-21(15-23)16-24(26)14-20/h1-8,12,20-21,23-26H,9-11,13-17H2,(H3,30,31)(H2,32,33,35) |
| InChIKey | CSTFHXXNSPVALQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|