C22H29N5 — CID 68906970
3-[5-(4-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]-3-(1-methylpiperidin-4-yl)propan-1-amine (PubChem CID 68906970) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is 3-[5-(4-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]-3-(1-methylpiperidin-4-yl)propan-1-amine.
| Compound Name | 3-[5-(4-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]-3-(1-methylpiperidin-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 68906970 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 3-[5-(4-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]-3-(1-methylpiperidin-4-yl)propan-1-amine |
| SMILES | Cc1cccc2[nH]c(-c3ccc(C(CCN)C4CCN(C)CC4)nc3)nc12 |
| InChI | InChI=1S/C22H29N5/c1-15-4-3-5-20-21(15)26-22(25-20)17-6-7-19(24-14-17)18(8-11-23)16-9-12-27(2)13-10-16/h3-7,14,16,18H,8-13,23H2,1-2H3,(H,25,26) |
| InChIKey | KZOXNRLNQNMOKY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |