C25H30FNOSi — CID 68911746
(2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(4-fluorophenyl)propan-2-amine (PubChem CID 68911746) has the molecular formula C25H30FNOSi and a molecular weight of 407.61 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(4-fluorophenyl)propan-2-amine.
| Compound Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(4-fluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 68911746 |
| Molecular Formula | C25H30FNOSi |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(4-fluorophenyl)propan-2-amine |
| SMILES | CC(C)(C)[Si](O[C@@](C)(N)Cc1ccc(F)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30FNOSi/c1-24(2,3)29(22-11-7-5-8-12-22,23-13-9-6-10-14-23)28-25(4,27)19-20-15-17-21(26)18-16-20/h5-18H,19,27H2,1-4H3/t25-/m1/s1 |
| InChIKey | QVQZZEUSIKKPOA-RUZDIDTESA-N |
| XLogP | 4.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|