C22H30FN3O4S — CID 68912258
tert-butyl 4-[3-[3-(3-fluoro-4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]propoxy]piperidine-1-carboxylate (PubChem CID 68912258) has the molecular formula C22H30FN3O4S and a molecular weight of 451.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-(3-fluoro-4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]propoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-(3-fluoro-4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]propoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68912258 |
| Molecular Formula | C22H30FN3O4S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | tert-butyl 4-[3-[3-(3-fluoro-4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]propoxy]piperidine-1-carboxylate |
| SMILES | CSc1ccc(-c2noc(CCCOC3CCN(C(=O)OC(C)(C)C)CC3)n2)cc1F |
| InChI | InChI=1S/C22H30FN3O4S/c1-22(2,3)29-21(27)26-11-9-16(10-12-26)28-13-5-6-19-24-20(25-30-19)15-7-8-18(31-4)17(23)14-15/h7-8,14,16H,5-6,9-13H2,1-4H3 |
| InChIKey | FYSRFJCFZZTPHU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|