C22H34FNO3S — CID 59234118
tert-butyl 4-[4-(3-fluoro-4-methylsulfanylphenyl)-1-methoxybutyl]piperidine-1-carboxylate (PubChem CID 59234118) has the molecular formula C22H34FNO3S and a molecular weight of 411.58 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-fluoro-4-methylsulfanylphenyl)-1-methoxybutyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-fluoro-4-methylsulfanylphenyl)-1-methoxybutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59234118 |
| Molecular Formula | C22H34FNO3S |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | tert-butyl 4-[4-(3-fluoro-4-methylsulfanylphenyl)-1-methoxybutyl]piperidine-1-carboxylate |
| SMILES | COC(CCCc1ccc(SC)c(F)c1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H34FNO3S/c1-22(2,3)27-21(25)24-13-11-17(12-14-24)19(26-4)8-6-7-16-9-10-20(28-5)18(23)15-16/h9-10,15,17,19H,6-8,11-14H2,1-5H3 |
| InChIKey | PSKWXJLVMFSTIE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |