C21H27F3N4O3 — CID 166210849
tert-butyl 3-[1-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]piperidine-1-carboxylate (PubChem CID 166210849) has the molecular formula C21H27F3N4O3 and a molecular weight of 440.47 g/mol. Its IUPAC name is tert-butyl 3-[1-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166210849 |
| Molecular Formula | C21H27F3N4O3 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | tert-butyl 3-[1-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(NCc1nc(-c2cc(F)c(F)c(F)c2)no1)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H27F3N4O3/c1-12(13-6-5-7-28(11-13)20(29)30-21(2,3)4)25-10-17-26-19(27-31-17)14-8-15(22)18(24)16(23)9-14/h8-9,12-13,25H,5-7,10-11H2,1-4H3 |
| InChIKey | VXNLZVUJLLRECJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|