C21H17BrF3N3O5S — CID 166378826
5-O-tert-butyl 2-O-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl] 3-bromo-4,6-dihydrothieno[2,3-c]pyrrole-2,5-dicarboxylate (PubChem CID 166378826) has the molecular formula C21H17BrF3N3O5S and a molecular weight of 560.35 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl] 3-bromo-4,6-dihydrothieno[2,3-c]pyrrole-2,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 2-O-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl] 3-bromo-4,6-dihydrothieno[2,3-c]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 166378826 |
| Molecular Formula | C21H17BrF3N3O5S |
| Molecular Weight | 560.35 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | 5-O-tert-butyl 2-O-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl] 3-bromo-4,6-dihydrothieno[2,3-c]pyrrole-2,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2sc(C(=O)OCc3nc(-c4cc(F)c(F)c(F)c4)no3)c(Br)c2C1 |
| InChI | InChI=1S/C21H17BrF3N3O5S/c1-21(2,3)32-20(30)28-6-10-13(7-28)34-17(15(10)22)19(29)31-8-14-26-18(27-33-14)9-4-11(23)16(25)12(24)5-9/h4-5H,6-8H2,1-3H3 |
| InChIKey | PPXWPDNYRXUVOO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|