C21H21NO4 — CID 68913001
[1-[(4-methoxyphenyl)methyl]-4-methyl-3-(4-methylphenyl)pyrrol-2-yl] hydrogen carbonate (PubChem CID 68913001) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is [1-[(4-methoxyphenyl)methyl]-4-methyl-3-(4-methylphenyl)pyrrol-2-yl] hydrogen carbonate.
| Compound Name | [1-[(4-methoxyphenyl)methyl]-4-methyl-3-(4-methylphenyl)pyrrol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68913001 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [1-[(4-methoxyphenyl)methyl]-4-methyl-3-(4-methylphenyl)pyrrol-2-yl] hydrogen carbonate |
| SMILES | COc1ccc(Cn2cc(C)c(-c3ccc(C)cc3)c2OC(=O)O)cc1 |
| InChI | InChI=1S/C21H21NO4/c1-14-4-8-17(9-5-14)19-15(2)12-22(20(19)26-21(23)24)13-16-6-10-18(25-3)11-7-16/h4-12H,13H2,1-3H3,(H,23,24) |
| InChIKey | DUFKNTGURGTKHA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |