C28H38NO2+ — CID 68915619
2-[(4-tert-butylphenyl)methyl]-1-hexyl-6,7-dimethoxyisoquinolin-2-ium (PubChem CID 68915619) has the molecular formula C28H38NO2+ and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-1-hexyl-6,7-dimethoxyisoquinolin-2-ium.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-1-hexyl-6,7-dimethoxyisoquinolin-2-ium |
|---|---|
| PubChem CID | 68915619 |
| Molecular Formula | C28H38NO2+ |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-1-hexyl-6,7-dimethoxyisoquinolin-2-ium |
| SMILES | CCCCCCc1c2cc(OC)c(OC)cc2cc[n+]1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H38NO2/c1-7-8-9-10-11-25-24-19-27(31-6)26(30-5)18-22(24)16-17-29(25)20-21-12-14-23(15-13-21)28(2,3)4/h12-19H,7-11,20H2,1-6H3/q+1 |
| InChIKey | UWUBDKJAOVOSQT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|